C14H11ClF2O3S — CID 19804798
2-(benzenesulfonyl)-1-(2-chlorophenyl)-2,2-difluoroethanol (PubChem CID 19804798) has the molecular formula C14H11ClF2O3S and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(2-chlorophenyl)-2,2-difluoroethanol.
| Compound Name | 2-(benzenesulfonyl)-1-(2-chlorophenyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 19804798 |
| Molecular Formula | C14H11ClF2O3S |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(2-chlorophenyl)-2,2-difluoroethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C14H11ClF2O3S/c15-12-9-5-4-8-11(12)13(18)14(16,17)21(19,20)10-6-2-1-3-7-10/h1-9,13,18H |
| InChIKey | SWIJBBBMCNAMKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |