(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid

C9H8ClF2NO2 — CID 53487758

IUPAC(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid
SMILESN[C@@H](c1ccccc1Cl)C(F)(F)C(=O)O
InChIInChI=1S/C9H8ClF2NO2/c10-6-4-2-1-3-5(6)7(13)9(11,12)8(14)15/h1-4,7H,13H2,(H,14,15)/t7-/m0/s1
InChIKeyOMHIUTWGVYFNRY-ZETCQYMHSA-N
MW235.62 g/mol
LogP2.06
Rot. Bonds3

About (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid

(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid (PubChem CID 53487758) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid.

Molecular Properties

Compound Name(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid
PubChem CID53487758
Molecular FormulaC9H8ClF2NO2
Molecular Weight235.62 g/mol
Exact Mass235.02
IUPAC Name(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid
SMILESN[C@@H](c1ccccc1Cl)C(F)(F)C(=O)O
InChIInChI=1S/C9H8ClF2NO2/c10-6-4-2-1-3-5(6)7(13)9(11,12)8(14)15/h1-4,7H,13H2,(H,14,15)/t7-/m0/s1
InChIKeyOMHIUTWGVYFNRY-ZETCQYMHSA-N
XLogP2.06
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.62
LogP ≤ 52.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid?
The IUPAC name of (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid (CID 53487758) is (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid.
What is the SMILES notation for (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid?
The canonical SMILES for (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid is N[C@@H](c1ccccc1Cl)C(F)(F)C(=O)O.
What is the InChIKey of (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid?
The InChIKey is OMHIUTWGVYFNRY-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H8ClF2NO2/c10-6-4-2-1-3-5(6)7(13)9(11,12)8(14)15/h1-4,7H,13H2,(H,14,15)/t7-/m0/s1.
What are the key properties of (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid?
(3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid has a molecular weight of 235.62 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3-(2-chlorophenyl)-2,2-difluoropropanoic acid is sourced from PubChem (CID 53487758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).