C9H7ClF3NO2 — CID 66511591
3-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-chlorobenzoic acid (PubChem CID 66511591) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-chlorobenzoic acid.
| Compound Name | 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 66511591 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-chlorobenzoic acid |
| SMILES | N[C@@H](c1cc(C(=O)O)ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO2/c10-6-2-1-4(8(15)16)3-5(6)7(14)9(11,12)13/h1-3,7H,14H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | NOWHWVDDGJSGJW-ZETCQYMHSA-N |
| XLogP | 2.60 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |