3-chloro-4-iodobenzoic acid

C7H4ClIO2 — CID 18953341

IUPAC3-chloro-4-iodobenzoic acid
SMILESO=C(O)c1ccc(I)c(Cl)c1
InChIInChI=1S/C7H4ClIO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11)
InChIKeyUTKNSLUWERDCPS-UHFFFAOYSA-N
MW282.46 g/mol
LogP2.64
Rot. Bonds1

About 3-chloro-4-iodobenzoic acid

3-chloro-4-iodobenzoic acid (PubChem CID 18953341) has the molecular formula C7H4ClIO2 and a molecular weight of 282.46 g/mol. Its IUPAC name is 3-chloro-4-iodobenzoic acid.

Molecular Properties

Compound Name3-chloro-4-iodobenzoic acid
PubChem CID18953341
Molecular FormulaC7H4ClIO2
Molecular Weight282.46 g/mol
Exact Mass281.89
IUPAC Name3-chloro-4-iodobenzoic acid
SMILESO=C(O)c1ccc(I)c(Cl)c1
InChIInChI=1S/C7H4ClIO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11)
InChIKeyUTKNSLUWERDCPS-UHFFFAOYSA-N
XLogP2.64
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.46
LogP ≤ 52.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-chloro-4-iodobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-4-iodobenzoic acid?
The IUPAC name of 3-chloro-4-iodobenzoic acid (CID 18953341) is 3-chloro-4-iodobenzoic acid.
What is the SMILES notation for 3-chloro-4-iodobenzoic acid?
The canonical SMILES for 3-chloro-4-iodobenzoic acid is O=C(O)c1ccc(I)c(Cl)c1.
What is the InChIKey of 3-chloro-4-iodobenzoic acid?
The InChIKey is UTKNSLUWERDCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClIO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11).
What are the key properties of 3-chloro-4-iodobenzoic acid?
3-chloro-4-iodobenzoic acid has a molecular weight of 282.46 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-iodobenzoic acid is sourced from PubChem (CID 18953341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).