About 3-chloro-4-iodobenzamide
3-chloro-4-iodobenzamide (PubChem CID 94675118) has the molecular formula C7H5ClINO
and a molecular weight of 281.48 g/mol. Its IUPAC name is 3-chloro-4-iodobenzamide.
Molecular Properties
| Compound Name | 3-chloro-4-iodobenzamide |
| PubChem CID | 94675118 |
| Molecular Formula | C7H5ClINO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 280.91 |
| IUPAC Name | 3-chloro-4-iodobenzamide |
| SMILES | NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C7H5ClINO/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
| InChIKey | XKCNEYGVLIFIRH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-iodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-iodobenzamide?
The IUPAC name of 3-chloro-4-iodobenzamide (CID 94675118) is 3-chloro-4-iodobenzamide.
What is the SMILES notation for 3-chloro-4-iodobenzamide?
The canonical SMILES for 3-chloro-4-iodobenzamide is NC(=O)c1ccc(I)c(Cl)c1.
What is the InChIKey of 3-chloro-4-iodobenzamide?
The InChIKey is XKCNEYGVLIFIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClINO/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11).
What are the key properties of 3-chloro-4-iodobenzamide?
3-chloro-4-iodobenzamide has a molecular weight of 281.48 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-iodobenzamide is sourced from PubChem (CID 94675118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).