About (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate
(2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate (PubChem CID 71924047) has the molecular formula C9H7ClINO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate |
| PubChem CID | 71924047 |
| Molecular Formula | C9H7ClINO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate |
| SMILES | NC(=O)COC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C9H7ClINO3/c10-6-3-5(1-2-7(6)11)9(14)15-4-8(12)13/h1-3H,4H2,(H2,12,13) |
| InChIKey | PDZQPJPLHXPNAL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate?
The IUPAC name of (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate (CID 71924047) is (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate?
The canonical SMILES for (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate is NC(=O)COC(=O)c1ccc(I)c(Cl)c1.
What is the InChIKey of (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate?
The InChIKey is PDZQPJPLHXPNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClINO3/c10-6-3-5(1-2-7(6)11)9(14)15-4-8(12)13/h1-3H,4H2,(H2,12,13).
What are the key properties of (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate?
(2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate has a molecular weight of 339.52 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 3-chloro-4-iodobenzoate is sourced from PubChem (CID 71924047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).