About (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate
(2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate (PubChem CID 3923903) has the molecular formula C18H16N2O7
and a molecular weight of 372.33 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate |
| PubChem CID | 3923903 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate |
| SMILES | NC(=O)COC(=O)c1ccc(Oc2ccc(C(=O)OCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C18H16N2O7/c19-15(21)9-25-17(23)11-1-5-13(6-2-11)27-14-7-3-12(4-8-14)18(24)26-10-16(20)22/h1-8H,9-10H2,(H2,19,21)(H2,20,22) |
| InChIKey | QIMKODLAHKLPAG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate?
The IUPAC name of (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate (CID 3923903) is (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate?
The canonical SMILES for (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate is NC(=O)COC(=O)c1ccc(Oc2ccc(C(=O)OCC(N)=O)cc2)cc1.
What is the InChIKey of (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate?
The InChIKey is QIMKODLAHKLPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O7/c19-15(21)9-25-17(23)11-1-5-13(6-2-11)27-14-7-3-12(4-8-14)18(24)26-10-16(20)22/h1-8H,9-10H2,(H2,19,21)(H2,20,22).
What are the key properties of (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate?
(2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate has a molecular weight of 372.33 g/mol, XLogP of 0.76, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 4-[4-(2-amino-2-oxoethoxy)carbonylphenoxy]benzoate is sourced from PubChem (CID 3923903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).