C20H16F2O4S — CID 19804790
2-(benzenesulfonyl)-2,2-difluoro-1-(2-phenoxyphenyl)ethanol (PubChem CID 19804790) has the molecular formula C20H16F2O4S and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,2-difluoro-1-(2-phenoxyphenyl)ethanol.
| Compound Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(2-phenoxyphenyl)ethanol |
|---|---|
| PubChem CID | 19804790 |
| Molecular Formula | C20H16F2O4S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(2-phenoxyphenyl)ethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H16F2O4S/c21-20(22,27(24,25)16-11-5-2-6-12-16)19(23)17-13-7-8-14-18(17)26-15-9-3-1-4-10-15/h1-14,19,23H |
| InChIKey | RRVANIIVOJQYDL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |