C21H14F6O2 — CID 139796245
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-diphenoxybenzene (PubChem CID 139796245) has the molecular formula C21H14F6O2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-diphenoxybenzene.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-diphenoxybenzene |
|---|---|
| PubChem CID | 139796245 |
| Molecular Formula | C21H14F6O2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,3-diphenoxybenzene |
| SMILES | FC(F)(F)C(c1cccc(Oc2ccccc2)c1Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H14F6O2/c22-20(23,24)19(21(25,26)27)16-12-7-13-17(28-14-8-3-1-4-9-14)18(16)29-15-10-5-2-6-11-15/h1-13,19H |
| InChIKey | KFDOWOQVWRDLOQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |