C14H16N2O — CID 66518149
(1S)-1-(2-phenoxyphenyl)ethane-1,2-diamine (PubChem CID 66518149) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is (1S)-1-(2-phenoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-phenoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66518149 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (1S)-1-(2-phenoxyphenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c15-10-13(16)12-8-4-5-9-14(12)17-11-6-2-1-3-7-11/h1-9,13H,10,15-16H2/t13-/m1/s1 |
| InChIKey | AHEBCEMJDMLTAW-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |