C16H20F4O5S2 — CID 86671332
[4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl methanesulfonate (PubChem CID 86671332) has the molecular formula C16H20F4O5S2 and a molecular weight of 432.46 g/mol. Its IUPAC name is [4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl methanesulfonate.
| Compound Name | [4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86671332 |
| Molecular Formula | C16H20F4O5S2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl methanesulfonate |
| SMILES | CC1(COS(C)(=O)=O)CCC(F)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H20F4O5S2/c1-14(11-25-26(2,21)22)6-8-15(17,9-7-14)27(23,24)13-5-3-4-12(10-13)16(18,19)20/h3-5,10H,6-9,11H2,1-2H3 |
| InChIKey | FCCRKDJILQPMIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|