C21H23F4NO2S — CID 67054701
N-benzyl-4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-amine (PubChem CID 67054701) has the molecular formula C21H23F4NO2S and a molecular weight of 429.48 g/mol. Its IUPAC name is N-benzyl-4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-amine.
| Compound Name | N-benzyl-4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 67054701 |
| Molecular Formula | C21H23F4NO2S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-benzyl-4-fluoro-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-amine |
| SMILES | CC1(NCc2ccccc2)CCC(F)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H23F4NO2S/c1-19(26-15-16-6-3-2-4-7-16)10-12-20(22,13-11-19)29(27,28)18-9-5-8-17(14-18)21(23,24)25/h2-9,14,26H,10-13,15H2,1H3 |
| InChIKey | KOYSDCWEVZRRSS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |