C20H12F6O6S2 — CID 23452805
6-[3-(trifluoromethyl)phenyl]sulfonyloxyhexa-2,4-diynyl 3-(trifluoromethyl)benzenesulfonate (PubChem CID 23452805) has the molecular formula C20H12F6O6S2 and a molecular weight of 526.43 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]sulfonyloxyhexa-2,4-diynyl 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | 6-[3-(trifluoromethyl)phenyl]sulfonyloxyhexa-2,4-diynyl 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 23452805 |
| Molecular Formula | C20H12F6O6S2 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]sulfonyloxyhexa-2,4-diynyl 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(OCC#CC#CCOS(=O)(=O)c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12F6O6S2/c21-19(22,23)15-7-5-9-17(13-15)33(27,28)31-11-3-1-2-4-12-32-34(29,30)18-10-6-8-16(14-18)20(24,25)26/h5-10,13-14H,11-12H2 |
| InChIKey | SZPYGMRIBLDZDR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|