C24H16F6N2O10S2 — CID 91246693
[1,3,5,7-tetrahydroxy-2-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 91246693) has the molecular formula C24H16F6N2O10S2 and a molecular weight of 670.52 g/mol. Its IUPAC name is [1,3,5,7-tetrahydroxy-2-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [1,3,5,7-tetrahydroxy-2-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 91246693 |
| Molecular Formula | C24H16F6N2O10S2 |
| Molecular Weight | 670.52 g/mol |
| Exact Mass | 670.02 |
| IUPAC Name | [1,3,5,7-tetrahydroxy-2-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,8-dihydropyrrolo[3,4-f]isoindol-6-yl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)Cc1c(c(O)n(OS(=O)(=O)c3cccc(C(F)(F)F)c3)c1O)C2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F6N2O10S2/c25-23(26,27)11-3-1-5-13(7-11)43(37,38)41-31-19(33)15-9-17-18(10-16(15)20(31)34)22(36)32(21(17)35)42-44(39,40)14-6-2-4-12(8-14)24(28,29)30/h1-8,33-36H,9-10H2 |
| InChIKey | RVHLLPNMCNBGCT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |