C26H16F6N2O10S2 — CID 90721959
[3,5,9,11-tetrahydroxy-10-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 90721959) has the molecular formula C26H16F6N2O10S2 and a molecular weight of 694.54 g/mol. Its IUPAC name is [3,5,9,11-tetrahydroxy-10-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3,5,9,11-tetrahydroxy-10-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 90721959 |
| Molecular Formula | C26H16F6N2O10S2 |
| Molecular Weight | 694.54 g/mol |
| Exact Mass | 694.02 |
| IUPAC Name | [3,5,9,11-tetrahydroxy-10-[3-(trifluoromethyl)phenyl]sulfonyloxy-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11,13-pentaen-4-yl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C=CC2c2c1c(O)n(OS(=O)(=O)c1cccc(C(F)(F)F)c1)c2O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H16F6N2O10S2/c27-25(28,29)11-3-1-5-13(9-11)45(39,40)43-33-21(35)17-15-7-8-16(18(17)22(33)36)20-19(15)23(37)34(24(20)38)44-46(41,42)14-6-2-4-12(10-14)26(30,31)32/h1-10,15-16,35-38H |
| InChIKey | YKZLRXQZINSMEQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|