C69H36F39O4S3Sb — CID 139924217
tris[bis[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate (PubChem CID 139924217) has the molecular formula C69H36F39O4S3Sb and a molecular weight of 1887.93 g/mol. Its IUPAC name is tris[bis[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate.
| Compound Name | tris[bis[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate |
|---|---|
| PubChem CID | 139924217 |
| Molecular Formula | C69H36F39O4S3Sb |
| Molecular Weight | 1887.93 g/mol |
| Exact Mass | 1886.02 |
| IUPAC Name | tris[bis[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate |
| SMILES | O=[Sb](OS(c1ccc(C(F)(F)C(F)(F)F)cc1)(c1ccc(C(F)(F)C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1)(OS(c1ccc(C(F)(F)C(F)(F)F)cc1)(c1ccc(C(F)(F)C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1)OS(c1ccc(C(F)(F)C(F)(F)F)cc1)(c1ccc(C(F)(F)C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/3C23H13F13OS.O.Sb/c3*24-19(25,22(31,32)33)13-4-8-16(9-5-13)38(37,18-3-1-2-15(12-18)21(28,29)30)17-10-6-14(7-11-17)20(26,27)23(34,35)36;;/h3*1-12,37H;;/q;;;;+3/p-3 |
| InChIKey | KYDBIUJQOHDODU-UHFFFAOYSA-K |
| XLogP | 28.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 116 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1887.93 |
| LogP ≤ 5 | 28.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|