C69H66F9O4S3Sb — CID 139924092
tris[bis(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate (PubChem CID 139924092) has the molecular formula C69H66F9O4S3Sb and a molecular weight of 1348.23 g/mol. Its IUPAC name is tris[bis(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate.
| Compound Name | tris[bis(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate |
|---|---|
| PubChem CID | 139924092 |
| Molecular Formula | C69H66F9O4S3Sb |
| Molecular Weight | 1348.23 g/mol |
| Exact Mass | 1346.30 |
| IUPAC Name | tris[bis(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]-λ4-sulfanyl] stiborate |
| SMILES | CCc1ccc(S(O[Sb](=O)(OS(c2ccc(CC)cc2)(c2ccc(CC)cc2)c2cccc(C(F)(F)F)c2)OS(c2ccc(CC)cc2)(c2ccc(CC)cc2)c2cccc(C(F)(F)F)c2)(c2ccc(CC)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/3C23H23F3OS.O.Sb/c3*1-3-17-8-12-20(13-9-17)28(27,21-14-10-18(4-2)11-15-21)22-7-5-6-19(16-22)23(24,25)26;;/h3*5-16,27H,3-4H2,1-2H3;;/q;;;;+3/p-3 |
| InChIKey | GYBVJCWEDZEMJH-UHFFFAOYSA-K |
| XLogP | 22.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1348.23 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|