C11H13F3O5S2 — CID 162588700
3-[3-(trifluoromethyl)phenyl]sulfonylpropyl methanesulfonate (PubChem CID 162588700) has the molecular formula C11H13F3O5S2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]sulfonylpropyl methanesulfonate.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]sulfonylpropyl methanesulfonate |
|---|---|
| PubChem CID | 162588700 |
| Molecular Formula | C11H13F3O5S2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]sulfonylpropyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3O5S2/c1-20(15,16)19-6-3-7-21(17,18)10-5-2-4-9(8-10)11(12,13)14/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | XKMQLHHFOQPKQN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|