C13H15F3O3S — CID 106807681
6-[3-(trifluoromethyl)phenyl]sulfonylhexan-3-one (PubChem CID 106807681) has the molecular formula C13H15F3O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]sulfonylhexan-3-one.
| Compound Name | 6-[3-(trifluoromethyl)phenyl]sulfonylhexan-3-one |
|---|---|
| PubChem CID | 106807681 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]sulfonylhexan-3-one |
| SMILES | CCC(=O)CCCS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3O3S/c1-2-11(17)6-4-8-20(18,19)12-7-3-5-10(9-12)13(14,15)16/h3,5,7,9H,2,4,6,8H2,1H3 |
| InChIKey | WBWLOJXCFIAASY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |