C17H17F3N2O3S2 — CID 154077259
N-[2-[2-[3-(trifluoromethyl)phenyl]sulfonylethylsulfanyl]-3-pyridinyl]propanamide (PubChem CID 154077259) has the molecular formula C17H17F3N2O3S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[2-[2-[3-(trifluoromethyl)phenyl]sulfonylethylsulfanyl]-3-pyridinyl]propanamide.
| Compound Name | N-[2-[2-[3-(trifluoromethyl)phenyl]sulfonylethylsulfanyl]-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 154077259 |
| Molecular Formula | C17H17F3N2O3S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[2-[2-[3-(trifluoromethyl)phenyl]sulfonylethylsulfanyl]-3-pyridinyl]propanamide |
| SMILES | CCC(=O)Nc1cccnc1SCCS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O3S2/c1-2-15(23)22-14-7-4-8-21-16(14)26-9-10-27(24,25)13-6-3-5-12(11-13)17(18,19)20/h3-8,11H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | RSYXLUVARLBWHR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |