C19H14F3N3O2 — CID 108956077
N'-quinolin-8-yl-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108956077) has the molecular formula C19H14F3N3O2 and a molecular weight of 373.33 g/mol. Its IUPAC name is N'-quinolin-8-yl-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-quinolin-8-yl-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108956077 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N'-quinolin-8-yl-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc2cccnc12)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N3O2/c20-19(21,22)13-6-2-7-14(10-13)24-16(26)11-17(27)25-15-8-1-4-12-5-3-9-23-18(12)15/h1-10H,11H2,(H,24,26)(H,25,27) |
| InChIKey | VVYHQDLXPFACLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|