C18H13F2N3O2 — CID 108956736
N-(2,4-difluorophenyl)-N'-quinolin-8-ylpropanediamide (PubChem CID 108956736) has the molecular formula C18H13F2N3O2 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N'-quinolin-8-ylpropanediamide.
| Compound Name | N-(2,4-difluorophenyl)-N'-quinolin-8-ylpropanediamide |
|---|---|
| PubChem CID | 108956736 |
| Molecular Formula | C18H13F2N3O2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-N'-quinolin-8-ylpropanediamide |
| SMILES | O=C(CC(=O)Nc1cccc2cccnc12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F2N3O2/c19-12-6-7-14(13(20)9-12)22-16(24)10-17(25)23-15-5-1-3-11-4-2-8-21-18(11)15/h1-9H,10H2,(H,22,24)(H,23,25) |
| InChIKey | KZIHYKKYAPRFJL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|