C19H15F2N3O2 — CID 113178774
2-[acetyl(quinolin-8-yl)amino]-N-(2,4-difluorophenyl)acetamide (PubChem CID 113178774) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is 2-[acetyl(quinolin-8-yl)amino]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[acetyl(quinolin-8-yl)amino]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 113178774 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[acetyl(quinolin-8-yl)amino]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(F)cc1F)c1cccc2cccnc12 |
| InChI | InChI=1S/C19H15F2N3O2/c1-12(25)24(17-6-2-4-13-5-3-9-22-19(13)17)11-18(26)23-16-8-7-14(20)10-15(16)21/h2-10H,11H2,1H3,(H,23,26) |
| InChIKey | MFPHXKNXGAFUTD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |