C19H16BrN3O2 — CID 113178742
2-[acetyl(quinolin-8-yl)amino]-N-(4-bromophenyl)acetamide (PubChem CID 113178742) has the molecular formula C19H16BrN3O2 and a molecular weight of 398.26 g/mol. Its IUPAC name is 2-[acetyl(quinolin-8-yl)amino]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[acetyl(quinolin-8-yl)amino]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 113178742 |
| Molecular Formula | C19H16BrN3O2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-[acetyl(quinolin-8-yl)amino]-N-(4-bromophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(Br)cc1)c1cccc2cccnc12 |
| InChI | InChI=1S/C19H16BrN3O2/c1-13(24)23(12-18(25)22-16-9-7-15(20)8-10-16)17-6-2-4-14-5-3-11-21-19(14)17/h2-11H,12H2,1H3,(H,22,25) |
| InChIKey | XCOHYHIJZAADTC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |