C22H23N3O4 — CID 113178693
2-[acetyl(quinolin-8-yl)amino]-N-[2-(4-methoxyphenoxy)ethyl]acetamide (PubChem CID 113178693) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[acetyl(quinolin-8-yl)amino]-N-[2-(4-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[acetyl(quinolin-8-yl)amino]-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 113178693 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[acetyl(quinolin-8-yl)amino]-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1ccc(OCCNC(=O)CN(C(C)=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-16(26)25(20-7-3-5-17-6-4-12-24-22(17)20)15-21(27)23-13-14-29-19-10-8-18(28-2)9-11-19/h3-12H,13-15H2,1-2H3,(H,23,27) |
| InChIKey | RGFYKVLSCNXZAQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|