C21H26N2O4 — CID 113167920
2-(N-acetyl-2,4-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]acetamide (PubChem CID 113167920) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(N-acetyl-2,4-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-(N-acetyl-2,4-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 113167920 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(N-acetyl-2,4-dimethylanilino)-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1ccc(OCCNC(=O)CN(C(C)=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-15-5-10-20(16(2)13-15)23(17(3)24)14-21(25)22-11-12-27-19-8-6-18(26-4)7-9-19/h5-10,13H,11-12,14H2,1-4H3,(H,22,25) |
| InChIKey | JBPDBRNJKFMVCC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|