C22H17F2N4O2+ — CID 165417027
2-[3-[2-(2,4-difluorophenyl)-2-oxoethyl]imidazol-3-ium-1-yl]-N-quinolin-8-ylacetamide (PubChem CID 165417027) has the molecular formula C22H17F2N4O2+ and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-[3-[2-(2,4-difluorophenyl)-2-oxoethyl]imidazol-3-ium-1-yl]-N-quinolin-8-ylacetamide.
| Compound Name | 2-[3-[2-(2,4-difluorophenyl)-2-oxoethyl]imidazol-3-ium-1-yl]-N-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 165417027 |
| Molecular Formula | C22H17F2N4O2+ |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[3-[2-(2,4-difluorophenyl)-2-oxoethyl]imidazol-3-ium-1-yl]-N-quinolin-8-ylacetamide |
| SMILES | O=C(Cn1cc[n+](CC(=O)c2ccc(F)cc2F)c1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H16F2N4O2/c23-16-6-7-17(18(24)11-16)20(29)12-27-9-10-28(14-27)13-21(30)26-19-5-1-3-15-4-2-8-25-22(15)19/h1-11,14H,12-13H2/p+1 |
| InChIKey | BKAVYYILRKRLQU-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|