C20H14FN3OS — CID 8850099
2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-quinolin-8-ylacetamide (PubChem CID 8850099) has the molecular formula C20H14FN3OS and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-quinolin-8-ylacetamide.
| Compound Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 8850099 |
| Molecular Formula | C20H14FN3OS |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]-N-quinolin-8-ylacetamide |
| SMILES | O=C(Cc1csc(-c2cccc(F)c2)n1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H14FN3OS/c21-15-7-1-5-14(10-15)20-23-16(12-26-20)11-18(25)24-17-8-2-4-13-6-3-9-22-19(13)17/h1-10,12H,11H2,(H,24,25) |
| InChIKey | YAXWCVLNQIXSFZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |