C16H20F4O5S2 — CID 87251554
methyl [4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methanesulfonate (PubChem CID 87251554) has the molecular formula C16H20F4O5S2 and a molecular weight of 432.46 g/mol. Its IUPAC name is methyl [4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methanesulfonate.
| Compound Name | methyl [4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methanesulfonate |
|---|---|
| PubChem CID | 87251554 |
| Molecular Formula | C16H20F4O5S2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | methyl [4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methanesulfonate |
| SMILES | COS(=O)(=O)CC1CCC(CF)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H20F4O5S2/c1-25-26(21,22)10-12-5-7-15(11-17,8-6-12)27(23,24)14-4-2-3-13(9-14)16(18,19)20/h2-4,9,12H,5-8,10-11H2,1H3 |
| InChIKey | UJCJQFXCXSDDIT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|