C14H17F3O5S2 — CID 174833897
[2-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-4-yl]methanesulfinic acid (PubChem CID 174833897) has the molecular formula C14H17F3O5S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is [2-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-4-yl]methanesulfinic acid.
| Compound Name | [2-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174833897 |
| Molecular Formula | C14H17F3O5S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [2-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-4-yl]methanesulfinic acid |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC(CS(=O)O)CCO1 |
| InChI | InChI=1S/C14H17F3O5S2/c1-13(8-10(5-6-22-13)9-23(18)19)24(20,21)12-4-2-3-11(7-12)14(15,16)17/h2-4,7,10H,5-6,8-9H2,1H3,(H,18,19) |
| InChIKey | ZKDSPJWWTNFAHA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|