C19H21F3N2O5S — CID 126744293
1-(methoxymethyl)-5-[4-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazole-3-carbaldehyde (PubChem CID 126744293) has the molecular formula C19H21F3N2O5S and a molecular weight of 446.45 g/mol. Its IUPAC name is 1-(methoxymethyl)-5-[4-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazole-3-carbaldehyde.
| Compound Name | 1-(methoxymethyl)-5-[4-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 126744293 |
| Molecular Formula | C19H21F3N2O5S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(methoxymethyl)-5-[4-methyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazole-3-carbaldehyde |
| SMILES | COCn1nc(C=O)cc1C1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC(C)CCO1 |
| InChI | InChI=1S/C19H21F3N2O5S/c1-13-6-7-29-18(10-13,17-9-15(11-25)23-24(17)12-28-2)30(26,27)16-5-3-4-14(8-16)19(20,21)22/h3-5,8-9,11,13H,6-7,10,12H2,1-2H3 |
| InChIKey | ZYYXCGRJJUPGDC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|