C13H18O2S — CID 134880406
(2S,3R)-2-(phenylsulfanylmethoxymethyl)-3-propyloxirane (PubChem CID 134880406) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (2S,3R)-2-(phenylsulfanylmethoxymethyl)-3-propyloxirane.
| Compound Name | (2S,3R)-2-(phenylsulfanylmethoxymethyl)-3-propyloxirane |
|---|---|
| PubChem CID | 134880406 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2S,3R)-2-(phenylsulfanylmethoxymethyl)-3-propyloxirane |
| SMILES | CCC[C@H]1O[C@H]1COCSc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-2-6-12-13(15-12)9-14-10-16-11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | NUXKEDSIKLGGAD-OLZOCXBDSA-N |
| XLogP | 3.32 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|