C15H22O2S — CID 134880405
(2R,3S)-2-pentyl-3-(phenylsulfanylmethoxymethyl)oxirane (PubChem CID 134880405) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is (2R,3S)-2-pentyl-3-(phenylsulfanylmethoxymethyl)oxirane.
| Compound Name | (2R,3S)-2-pentyl-3-(phenylsulfanylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 134880405 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2R,3S)-2-pentyl-3-(phenylsulfanylmethoxymethyl)oxirane |
| SMILES | CCCCC[C@H]1O[C@H]1COCSc1ccccc1 |
| InChI | InChI=1S/C15H22O2S/c1-2-3-5-10-14-15(17-14)11-16-12-18-13-8-6-4-7-9-13/h4,6-9,14-15H,2-3,5,10-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | PRIYKNHDMILHHT-CABCVRRESA-N |
| XLogP | 4.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|