C20H32OS — CID 134881675
(2S,3R)-2-(3,7-dimethyloctyl)-2-methyl-3-(phenylsulfanylmethyl)oxirane (PubChem CID 134881675) has the molecular formula C20H32OS and a molecular weight of 320.54 g/mol. Its IUPAC name is (2S,3R)-2-(3,7-dimethyloctyl)-2-methyl-3-(phenylsulfanylmethyl)oxirane.
| Compound Name | (2S,3R)-2-(3,7-dimethyloctyl)-2-methyl-3-(phenylsulfanylmethyl)oxirane |
|---|---|
| PubChem CID | 134881675 |
| Molecular Formula | C20H32OS |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2S,3R)-2-(3,7-dimethyloctyl)-2-methyl-3-(phenylsulfanylmethyl)oxirane |
| SMILES | CC(C)CCCC(C)CC[C@]1(C)O[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C20H32OS/c1-16(2)9-8-10-17(3)13-14-20(4)19(21-20)15-22-18-11-6-5-7-12-18/h5-7,11-12,16-17,19H,8-10,13-15H2,1-4H3/t17?,19-,20-/m0/s1 |
| InChIKey | UNTUICCIZNBEHC-MFUMQWNRSA-N |
| XLogP | 6.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|