C16H20O3S — CID 11335332
4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one (PubChem CID 11335332) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one.
| Compound Name | 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 11335332 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one |
| SMILES | O=C1OCCC(C2(Sc3ccccc3)CCCCC2)O1 |
| InChI | InChI=1S/C16H20O3S/c17-15-18-12-9-14(19-15)16(10-5-2-6-11-16)20-13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2 |
| InChIKey | ZDQXWRIJSIWSSE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |