C18H24O3S — CID 101257214
5,5-dimethyl-4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one (PubChem CID 101257214) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is 5,5-dimethyl-4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one.
| Compound Name | 5,5-dimethyl-4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 101257214 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5,5-dimethyl-4-(1-phenylsulfanylcyclohexyl)-1,3-dioxan-2-one |
| SMILES | CC1(C)COC(=O)OC1C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H24O3S/c1-17(2)13-20-16(19)21-15(17)18(11-7-4-8-12-18)22-14-9-5-3-6-10-14/h3,5-6,9-10,15H,4,7-8,11-13H2,1-2H3 |
| InChIKey | VMKXGCSZDOMGAB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |