C15H16O3S — CID 141356895
4-(1-phenylsulfanylcyclohexyl)-1,3-dioxol-2-one (PubChem CID 141356895) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxol-2-one.
| Compound Name | 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 141356895 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(1-phenylsulfanylcyclohexyl)-1,3-dioxol-2-one |
| SMILES | O=c1occ(C2(Sc3ccccc3)CCCCC2)o1 |
| InChI | InChI=1S/C15H16O3S/c16-14-17-11-13(18-14)15(9-5-2-6-10-15)19-12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | LXZDGAVUDFJGPQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |