C15H18O3S — CID 10901928
(5S)-8-(4-methylphenyl)sulfinyl-1,6-dioxaspiro[4.5]dec-7-ene (PubChem CID 10901928) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (5S)-8-(4-methylphenyl)sulfinyl-1,6-dioxaspiro[4.5]dec-7-ene.
| Compound Name | (5S)-8-(4-methylphenyl)sulfinyl-1,6-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 10901928 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (5S)-8-(4-methylphenyl)sulfinyl-1,6-dioxaspiro[4.5]dec-7-ene |
| SMILES | Cc1ccc(S(=O)C2=CO[C@@]3(CCCO3)CC2)cc1 |
| InChI | InChI=1S/C15H18O3S/c1-12-3-5-13(6-4-12)19(16)14-7-9-15(18-11-14)8-2-10-17-15/h3-6,11H,2,7-10H2,1H3/t15-,19?/m0/s1 |
| InChIKey | KXJAUXUDJGBQNJ-FUKCDUGKSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |