C12H16O3S — CID 15473194
2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxolan-2-ol (PubChem CID 15473194) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxolan-2-ol.
| Compound Name | 2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxolan-2-ol |
|---|---|
| PubChem CID | 15473194 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxolan-2-ol |
| SMILES | Cc1ccc([S@](=O)CC2(O)CCCO2)cc1 |
| InChI | InChI=1S/C12H16O3S/c1-10-3-5-11(6-4-10)16(14)9-12(13)7-2-8-15-12/h3-6,13H,2,7-9H2,1H3/t12?,16-/m1/s1 |
| InChIKey | HZCBDUZIJPNYJR-PVQCJRHBSA-N |
| XLogP | 1.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |