C17H22O3S — CID 11347324
2-[4-[(S)-(4-methylphenyl)sulfinyl]but-3-ynyl]-2-propyl-1,3-dioxolane (PubChem CID 11347324) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[4-[(S)-(4-methylphenyl)sulfinyl]but-3-ynyl]-2-propyl-1,3-dioxolane.
| Compound Name | 2-[4-[(S)-(4-methylphenyl)sulfinyl]but-3-ynyl]-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11347324 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[4-[(S)-(4-methylphenyl)sulfinyl]but-3-ynyl]-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(CCC#C[S@@](=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C17H22O3S/c1-3-10-17(19-12-13-20-17)11-4-5-14-21(18)16-8-6-15(2)7-9-16/h6-9H,3-4,10-13H2,1-2H3/t21-/m1/s1 |
| InChIKey | OVBIDXBQSSVEFS-OAQYLSRUSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|