C12H16O3S — CID 139037149
2-[2-[(R)-(4-methylphenyl)sulfinyl]ethyl]-1,3-dioxolane (PubChem CID 139037149) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-[2-[(R)-(4-methylphenyl)sulfinyl]ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-[(R)-(4-methylphenyl)sulfinyl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 139037149 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-[2-[(R)-(4-methylphenyl)sulfinyl]ethyl]-1,3-dioxolane |
| SMILES | Cc1ccc([S@](=O)CCC2OCCO2)cc1 |
| InChI | InChI=1S/C12H16O3S/c1-10-2-4-11(5-3-10)16(13)9-6-12-14-7-8-15-12/h2-5,12H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | ULJXWOMAKRHDJG-MRXNPFEDSA-N |
| XLogP | 1.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |