C13H17LiO4S — CID 135051165
lithium 2-methyl-2-[2-(4-methylphenyl)sulfonylethyl]-1,3-dioxolane (PubChem CID 135051165) has the molecular formula C13H17LiO4S and a molecular weight of 276.28 g/mol. Its IUPAC name is lithium 2-methyl-2-[2-(4-methylphenyl)sulfonylethyl]-1,3-dioxolane.
| Compound Name | lithium 2-methyl-2-[2-(4-methylphenyl)sulfonylethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 135051165 |
| Molecular Formula | C13H17LiO4S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | lithium 2-methyl-2-[2-(4-methylphenyl)sulfonylethyl]-1,3-dioxolane |
| SMILES | Cc1ccc(S(=O)(=O)[CH-]CC2(C)OCCO2)cc1.[Li+] |
| InChI | InChI=1S/C13H17O4S.Li/c1-11-3-5-12(6-4-11)18(14,15)10-7-13(2)16-8-9-17-13;/h3-6,10H,7-9H2,1-2H3;/q-1;+1 |
| InChIKey | YEUZWMXFTJPZJZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|