C16H20O3S — CID 134971579
8-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 134971579) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 8-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 8-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 134971579 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 8-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | Cc1ccc([S@@](=O)CC2=CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H20O3S/c1-13-2-4-15(5-3-13)20(17)12-14-6-8-16(9-7-14)18-10-11-19-16/h2-6H,7-12H2,1H3/t20-/m0/s1 |
| InChIKey | GYFFYXJBOZZNAL-FQEVSTJZSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|