C15H20OS — CID 24741288
4-butyl-4-phenylsulfanyl-2,3-dihydropyran (PubChem CID 24741288) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-butyl-4-phenylsulfanyl-2,3-dihydropyran.
| Compound Name | 4-butyl-4-phenylsulfanyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 24741288 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-butyl-4-phenylsulfanyl-2,3-dihydropyran |
| SMILES | CCCCC1(Sc2ccccc2)C=COCC1 |
| InChI | InChI=1S/C15H20OS/c1-2-3-9-15(10-12-16-13-11-15)17-14-7-5-4-6-8-14/h4-8,10,12H,2-3,9,11,13H2,1H3 |
| InChIKey | KBWZTTZYYKWMIY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |