C15H20O2S — CID 10869155
7-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 10869155) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 7-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 7-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10869155 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 7-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | c1ccc(SCC2CCCC3(C2)OCCO3)cc1 |
| InChI | InChI=1S/C15H20O2S/c1-2-6-14(7-3-1)18-12-13-5-4-8-15(11-13)16-9-10-17-15/h1-3,6-7,13H,4-5,8-12H2 |
| InChIKey | VIJLGJHYAKEUKI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |