C15H18O3S — CID 11737529
4-(phenylsulfanylmethyl)-1,3-dioxaspiro[4.5]decan-2-one (PubChem CID 11737529) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-1,3-dioxaspiro[4.5]decan-2-one.
| Compound Name | 4-(phenylsulfanylmethyl)-1,3-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 11737529 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-1,3-dioxaspiro[4.5]decan-2-one |
| SMILES | O=C1OC(CSc2ccccc2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C15H18O3S/c16-14-17-13(11-19-12-7-3-1-4-8-12)15(18-14)9-5-2-6-10-15/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | LXLNBFPLGZVKCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |