C16H22O2S — CID 11129631
9-(3-phenylsulfanylpropyl)-1,4-dioxaspiro[4.4]nonane (PubChem CID 11129631) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 9-(3-phenylsulfanylpropyl)-1,4-dioxaspiro[4.4]nonane.
| Compound Name | 9-(3-phenylsulfanylpropyl)-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 11129631 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 9-(3-phenylsulfanylpropyl)-1,4-dioxaspiro[4.4]nonane |
| SMILES | c1ccc(SCCCC2CCCC23OCCO3)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-2-8-15(9-3-1)19-13-5-7-14-6-4-10-16(14)17-11-12-18-16/h1-3,8-9,14H,4-7,10-13H2 |
| InChIKey | OQRPMGHCUURNAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|