C18H24O2S — CID 134876254
(9S)-6-methyl-7-phenylsulfanyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane (PubChem CID 134876254) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is (9S)-6-methyl-7-phenylsulfanyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (9S)-6-methyl-7-phenylsulfanyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134876254 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (9S)-6-methyl-7-phenylsulfanyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C(C)[C@@H]1CC(Sc2ccccc2)C(C)C2(C1)OCCO2 |
| InChI | InChI=1S/C18H24O2S/c1-13(2)15-11-17(21-16-7-5-4-6-8-16)14(3)18(12-15)19-9-10-20-18/h4-8,14-15,17H,1,9-12H2,2-3H3/t14?,15-,17?/m1/s1 |
| InChIKey | XRZBLUMOBOYTFT-ISXOHVOVSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|