C17H24O4S — CID 20653358
7-(benzenesulfonyl)-6,8,8-trimethyl-1,4-dioxaspiro[4.5]decane (PubChem CID 20653358) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-6,8,8-trimethyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | 7-(benzenesulfonyl)-6,8,8-trimethyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 20653358 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 7-(benzenesulfonyl)-6,8,8-trimethyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1C(S(=O)(=O)c2ccccc2)C(C)(C)CCC12OCCO2 |
| InChI | InChI=1S/C17H24O4S/c1-13-15(22(18,19)14-7-5-4-6-8-14)16(2,3)9-10-17(13)20-11-12-21-17/h4-8,13,15H,9-12H2,1-3H3 |
| InChIKey | SQVBZOOWTCUKNP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |