C17H22O4S — CID 71503841
8-[2-(4-methylphenyl)sulfonylethylidene]-1,4-dioxaspiro[4.5]decane (PubChem CID 71503841) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is 8-[2-(4-methylphenyl)sulfonylethylidene]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[2-(4-methylphenyl)sulfonylethylidene]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 71503841 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 8-[2-(4-methylphenyl)sulfonylethylidene]-1,4-dioxaspiro[4.5]decane |
| SMILES | Cc1ccc(S(=O)(=O)CC=C2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C17H22O4S/c1-14-2-4-16(5-3-14)22(18,19)13-8-15-6-9-17(10-7-15)20-11-12-21-17/h2-5,8H,6-7,9-13H2,1H3 |
| InChIKey | BMYLOVQONYBREH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|